C16H16FNS2 — CID 105137624
N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)-2-thiophen-3-ylethanamine (PubChem CID 105137624) has the molecular formula C16H16FNS2 and a molecular weight of 305.44 g/mol. Its IUPAC name is N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 105137624 |
| Molecular Formula | C16H16FNS2 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C16H16FNS2/c1-2-18-14(7-11-5-6-19-10-11)16-9-12-8-13(17)3-4-15(12)20-16/h3-6,8-10,14,18H,2,7H2,1H3 |
| InChIKey | QRPDTYUMDXBRAQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |