C10H13N3S2 — CID 105137529
N-ethyl-1-(thiadiazol-5-yl)-2-thiophen-3-ylethanamine (PubChem CID 105137529) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is N-ethyl-1-(thiadiazol-5-yl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(thiadiazol-5-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 105137529 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-ethyl-1-(thiadiazol-5-yl)-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)c1cnns1 |
| InChI | InChI=1S/C10H13N3S2/c1-2-11-9(10-6-12-13-15-10)5-8-3-4-14-7-8/h3-4,6-7,9,11H,2,5H2,1H3 |
| InChIKey | LYPUEKDQXWKHBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |