C14H16INS — CID 61078733
N-ethyl-1-(2-iodophenyl)-2-thiophen-3-ylethanamine (PubChem CID 61078733) has the molecular formula C14H16INS and a molecular weight of 357.26 g/mol. Its IUPAC name is N-ethyl-1-(2-iodophenyl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(2-iodophenyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 61078733 |
| Molecular Formula | C14H16INS |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-ethyl-1-(2-iodophenyl)-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)c1ccccc1I |
| InChI | InChI=1S/C14H16INS/c1-2-16-14(9-11-7-8-17-10-11)12-5-3-4-6-13(12)15/h3-8,10,14,16H,2,9H2,1H3 |
| InChIKey | BVUAQNAUGJVAJQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|