C14H15BrINS — CID 114027020
1-(2-bromo-5-iodophenyl)-N-ethyl-2-thiophen-3-ylethanamine (PubChem CID 114027020) has the molecular formula C14H15BrINS and a molecular weight of 436.16 g/mol. Its IUPAC name is 1-(2-bromo-5-iodophenyl)-N-ethyl-2-thiophen-3-ylethanamine.
| Compound Name | 1-(2-bromo-5-iodophenyl)-N-ethyl-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 114027020 |
| Molecular Formula | C14H15BrINS |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | 1-(2-bromo-5-iodophenyl)-N-ethyl-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)c1cc(I)ccc1Br |
| InChI | InChI=1S/C14H15BrINS/c1-2-17-14(7-10-5-6-18-9-10)12-8-11(16)3-4-13(12)15/h3-6,8-9,14,17H,2,7H2,1H3 |
| InChIKey | VMPQGDKNJQYCJR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|