C13H17NOS — CID 114821235
N-ethyl-1-(5-methylfuran-3-yl)-2-thiophen-3-ylethanamine (PubChem CID 114821235) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-ethyl-1-(5-methylfuran-3-yl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(5-methylfuran-3-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 114821235 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-ethyl-1-(5-methylfuran-3-yl)-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)c1coc(C)c1 |
| InChI | InChI=1S/C13H17NOS/c1-3-14-13(7-11-4-5-16-9-11)12-6-10(2)15-8-12/h4-6,8-9,13-14H,3,7H2,1-2H3 |
| InChIKey | OXTLYGKQESZVFD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |