C15H16F3NS — CID 61078735
N-ethyl-2-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 61078735) has the molecular formula C15H16F3NS and a molecular weight of 299.36 g/mol. Its IUPAC name is N-ethyl-2-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-ethyl-2-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 61078735 |
| Molecular Formula | C15H16F3NS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-ethyl-2-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CCNC(Cc1ccsc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NS/c1-2-19-14(8-11-6-7-20-10-11)12-4-3-5-13(9-12)15(16,17)18/h3-7,9-10,14,19H,2,8H2,1H3 |
| InChIKey | MEJDDTKKMVBMRH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |