C15H18FNS — CID 61078925
N-[1-(3-fluorophenyl)-2-thiophen-3-ylethyl]propan-1-amine (PubChem CID 61078925) has the molecular formula C15H18FNS and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)-2-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[1-(3-fluorophenyl)-2-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 61078925 |
| Molecular Formula | C15H18FNS |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[1-(3-fluorophenyl)-2-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccsc1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H18FNS/c1-2-7-17-15(9-12-6-8-18-11-12)13-4-3-5-14(16)10-13/h3-6,8,10-11,15,17H,2,7,9H2,1H3 |
| InChIKey | ZBOLPRJVNGCRBH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |