C16H20FNS — CID 81276214
N-[1-(4-fluoro-2-methylphenyl)-2-thiophen-3-ylethyl]propan-1-amine (PubChem CID 81276214) has the molecular formula C16H20FNS and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[1-(4-fluoro-2-methylphenyl)-2-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[1-(4-fluoro-2-methylphenyl)-2-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 81276214 |
| Molecular Formula | C16H20FNS |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[1-(4-fluoro-2-methylphenyl)-2-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccsc1)c1ccc(F)cc1C |
| InChI | InChI=1S/C16H20FNS/c1-3-7-18-16(10-13-6-8-19-11-13)15-5-4-14(17)9-12(15)2/h4-6,8-9,11,16,18H,3,7,10H2,1-2H3 |
| InChIKey | XIHSSLPLZDSHES-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |