C16H20FNS2 — CID 66073110
1-(3-fluorophenyl)sulfanyl-N-propyl-3-thiophen-3-ylpropan-2-amine (PubChem CID 66073110) has the molecular formula C16H20FNS2 and a molecular weight of 309.48 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfanyl-N-propyl-3-thiophen-3-ylpropan-2-amine.
| Compound Name | 1-(3-fluorophenyl)sulfanyl-N-propyl-3-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 66073110 |
| Molecular Formula | C16H20FNS2 |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-(3-fluorophenyl)sulfanyl-N-propyl-3-thiophen-3-ylpropan-2-amine |
| SMILES | CCCNC(CSc1cccc(F)c1)Cc1ccsc1 |
| InChI | InChI=1S/C16H20FNS2/c1-2-7-18-15(9-13-6-8-19-11-13)12-20-16-5-3-4-14(17)10-16/h3-6,8,10-11,15,18H,2,7,9,12H2,1H3 |
| InChIKey | PBWUEBOAHADLCD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |