C15H21FN4S — CID 107049649
1-(3-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)-N-propylpropan-2-amine (PubChem CID 107049649) has the molecular formula C15H21FN4S and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)-N-propylpropan-2-amine.
| Compound Name | 1-(3-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 107049649 |
| Molecular Formula | C15H21FN4S |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-(3-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)-N-propylpropan-2-amine |
| SMILES | CCCNC(CSc1cccc(F)c1)Cc1cn(C)nn1 |
| InChI | InChI=1S/C15H21FN4S/c1-3-7-17-14(9-13-10-20(2)19-18-13)11-21-15-6-4-5-12(16)8-15/h4-6,8,10,14,17H,3,7,9,11H2,1-2H3 |
| InChIKey | OLGHWNNRFUWQJF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |