C16H19BrFNS2 — CID 66071857
1-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)sulfanyl-N-propylpropan-2-amine (PubChem CID 66071857) has the molecular formula C16H19BrFNS2 and a molecular weight of 388.37 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)sulfanyl-N-propylpropan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)sulfanyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 66071857 |
| Molecular Formula | C16H19BrFNS2 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)sulfanyl-N-propylpropan-2-amine |
| SMILES | CCCNC(CSc1cccc(F)c1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H19BrFNS2/c1-2-8-19-13(10-15-6-7-16(17)21-15)11-20-14-5-3-4-12(18)9-14/h3-7,9,13,19H,2,8,10-11H2,1H3 |
| InChIKey | RAIVCYSLQHYUCF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |