C15H17BrFNS2 — CID 66066895
1-(5-bromothiophen-2-yl)-N-ethyl-3-(4-fluorophenyl)sulfanylpropan-2-amine (PubChem CID 66066895) has the molecular formula C15H17BrFNS2 and a molecular weight of 374.34 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-ethyl-3-(4-fluorophenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-ethyl-3-(4-fluorophenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 66066895 |
| Molecular Formula | C15H17BrFNS2 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-ethyl-3-(4-fluorophenyl)sulfanylpropan-2-amine |
| SMILES | CCNC(CSc1ccc(F)cc1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H17BrFNS2/c1-2-18-12(9-14-7-8-15(16)20-14)10-19-13-5-3-11(17)4-6-13/h3-8,12,18H,2,9-10H2,1H3 |
| InChIKey | CYPSGUCMYKAGBC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |