C16H20BrNS2 — CID 66054719
1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)-N-methylpropan-2-amine (PubChem CID 66054719) has the molecular formula C16H20BrNS2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66054719 |
| Molecular Formula | C16H20BrNS2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)-N-methylpropan-2-amine |
| SMILES | CCc1ccc(CC(CSc2ccc(Br)cc2)NC)s1 |
| InChI | InChI=1S/C16H20BrNS2/c1-3-14-8-9-16(20-14)10-13(18-2)11-19-15-6-4-12(17)5-7-15/h4-9,13,18H,3,10-11H2,1-2H3 |
| InChIKey | FRNQSGCFUKLPTL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |