C14H15BrFNS2 — CID 66053278
1-(5-bromothiophen-2-yl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine (PubChem CID 66053278) has the molecular formula C14H15BrFNS2 and a molecular weight of 360.32 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66053278 |
| Molecular Formula | C14H15BrFNS2 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSc1ccccc1F)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C14H15BrFNS2/c1-17-10(8-11-6-7-14(15)19-11)9-18-13-5-3-2-4-12(13)16/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | ITFFORGKHDXMAM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |