C16H17F2NS — CID 66051929
1-(4-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine (PubChem CID 66051929) has the molecular formula C16H17F2NS and a molecular weight of 293.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(4-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66051929 |
| Molecular Formula | C16H17F2NS |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSc1ccccc1F)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17F2NS/c1-19-14(10-12-6-8-13(17)9-7-12)11-20-16-5-3-2-4-15(16)18/h2-9,14,19H,10-11H2,1H3 |
| InChIKey | KMTQVTWNKNEOAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |