C16H16BrF2NS — CID 66053668
1-(2-bromo-5-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine (PubChem CID 66053668) has the molecular formula C16H16BrF2NS and a molecular weight of 372.28 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66053668 |
| Molecular Formula | C16H16BrF2NS |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-(2-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSc1ccccc1F)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C16H16BrF2NS/c1-20-13(9-11-8-12(18)6-7-14(11)17)10-21-16-5-3-2-4-15(16)19/h2-8,13,20H,9-10H2,1H3 |
| InChIKey | UTZKNPLNPQSFQO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |