C11H18BrNS2 — CID 65132170
1-(5-bromothiophen-2-yl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine (PubChem CID 65132170) has the molecular formula C11H18BrNS2 and a molecular weight of 308.31 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 65132170 |
| Molecular Formula | C11H18BrNS2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine |
| SMILES | CNC(CSC(C)C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C11H18BrNS2/c1-8(2)14-7-9(13-3)6-10-4-5-11(12)15-10/h4-5,8-9,13H,6-7H2,1-3H3 |
| InChIKey | GGBJYHVODKZFSO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |