C8H12BrNS — CID 62602112
1-(5-bromothiophen-2-yl)-N-methylpropan-2-amine (PubChem CID 62602112) has the molecular formula C8H12BrNS and a molecular weight of 234.16 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 62602112 |
| Molecular Formula | C8H12BrNS |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C8H12BrNS/c1-6(10-2)5-7-3-4-8(9)11-7/h3-4,6,10H,5H2,1-2H3 |
| InChIKey | QWHRPBHGLRQZBN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |