C15H17BrOS2 — CID 66054897
1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol (PubChem CID 66054897) has the molecular formula C15H17BrOS2 and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 66054897 |
| Molecular Formula | C15H17BrOS2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol |
| SMILES | CCc1ccc(CC(O)CSc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C15H17BrOS2/c1-2-13-7-8-15(19-13)9-12(17)10-18-14-5-3-11(16)4-6-14/h3-8,12,17H,2,9-10H2,1H3 |
| InChIKey | GGJJAEFOUFGGAH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |