C15H15F3OS2 — CID 65148012
2-(5-ethylthiophen-2-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol (PubChem CID 65148012) has the molecular formula C15H15F3OS2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol.
| Compound Name | 2-(5-ethylthiophen-2-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 65148012 |
| Molecular Formula | C15H15F3OS2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol |
| SMILES | CCc1ccc(CC(O)c2ccc(SC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C15H15F3OS2/c1-2-11-7-8-13(20-11)9-14(19)10-3-5-12(6-4-10)21-15(16,17)18/h3-8,14,19H,2,9H2,1H3 |
| InChIKey | BEJGKNQBPVEFDN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |