C9H9F3O2S — CID 73129063
1-[4-(trifluoromethylsulfanyl)phenyl]ethane-1,2-diol (PubChem CID 73129063) has the molecular formula C9H9F3O2S and a molecular weight of 238.23 g/mol. Its IUPAC name is 1-[4-(trifluoromethylsulfanyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[4-(trifluoromethylsulfanyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 73129063 |
| Molecular Formula | C9H9F3O2S |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-[4-(trifluoromethylsulfanyl)phenyl]ethane-1,2-diol |
| SMILES | OCC(O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3O2S/c10-9(11,12)15-7-3-1-6(2-4-7)8(14)5-13/h1-4,8,13-14H,5H2 |
| InChIKey | AWOBEXGIRQZIMA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |