C11H12F3NO3S — CID 171899706
3,4-dihydroxy-4-[4-(trifluoromethylsulfanyl)phenyl]butanamide (PubChem CID 171899706) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[4-(trifluoromethylsulfanyl)phenyl]butanamide.
| Compound Name | 3,4-dihydroxy-4-[4-(trifluoromethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 171899706 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3,4-dihydroxy-4-[4-(trifluoromethylsulfanyl)phenyl]butanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO3S/c12-11(13,14)19-7-3-1-6(2-4-7)10(18)8(16)5-9(15)17/h1-4,8,10,16,18H,5H2,(H2,15,17) |
| InChIKey | FPFKLMATTTWGON-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |