C10H12BrNO3 — CID 171900225
4-(4-bromophenyl)-3,4-dihydroxybutanamide (PubChem CID 171900225) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(4-bromophenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900225 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 4-(4-bromophenyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H12BrNO3/c11-7-3-1-6(2-4-7)10(15)8(13)5-9(12)14/h1-4,8,10,13,15H,5H2,(H2,12,14) |
| InChIKey | HLBQCULAAFAFMS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |