C11H15N3O4 — CID 171899571
4-[4-(carbamoylamino)phenyl]-3,4-dihydroxybutanamide (PubChem CID 171899571) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-[4-(carbamoylamino)phenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[4-(carbamoylamino)phenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899571 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-[4-(carbamoylamino)phenyl]-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C11H15N3O4/c12-9(16)5-8(15)10(17)6-1-3-7(4-2-6)14-11(13)18/h1-4,8,10,15,17H,5H2,(H2,12,16)(H3,13,14,18) |
| InChIKey | QVEHFUAYCGLTDP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |