C10H13BrN2O3 — CID 171860379
[4-(3-bromo-1,2-dihydroxypropyl)phenyl]urea (PubChem CID 171860379) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is [4-(3-bromo-1,2-dihydroxypropyl)phenyl]urea.
| Compound Name | [4-(3-bromo-1,2-dihydroxypropyl)phenyl]urea |
|---|---|
| PubChem CID | 171860379 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | [4-(3-bromo-1,2-dihydroxypropyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(O)C(O)CBr)cc1 |
| InChI | InChI=1S/C10H13BrN2O3/c11-5-8(14)9(15)6-1-3-7(4-2-6)13-10(12)16/h1-4,8-9,14-15H,5H2,(H3,12,13,16) |
| InChIKey | XCZYNLYDBGDIGB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|