C11H16N2O3S — CID 171874489
[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]urea (PubChem CID 171874489) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is [4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]urea.
| Compound Name | [4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]urea |
|---|---|
| PubChem CID | 171874489 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(O)C(O)CCS)cc1 |
| InChI | InChI=1S/C11H16N2O3S/c12-11(16)13-8-3-1-7(2-4-8)10(15)9(14)5-6-17/h1-4,9-10,14-15,17H,5-6H2,(H3,12,13,16) |
| InChIKey | MRKICIFKEKYWQD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|