C14H15F3O4S — CID 171875121
1-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-4,4,4-trifluorobutane-1,3-dione (PubChem CID 171875121) has the molecular formula C14H15F3O4S and a molecular weight of 336.33 g/mol. Its IUPAC name is 1-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 171875121 |
| Molecular Formula | C14H15F3O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-4,4,4-trifluorobutane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(C(O)C(O)CCS)cc1 |
| InChI | InChI=1S/C14H15F3O4S/c15-14(16,17)12(20)7-11(19)8-1-3-9(4-2-8)13(21)10(18)5-6-22/h1-4,10,13,18,21-22H,5-7H2 |
| InChIKey | JFPGVNUWINCQBX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|