C12H18N2O3 — CID 171881746
2-amino-1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone (PubChem CID 171881746) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-amino-1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone.
| Compound Name | 2-amino-1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171881746 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-amino-1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone |
| SMILES | NCCC(O)C(O)c1ccc(C(=O)CN)cc1 |
| InChI | InChI=1S/C12H18N2O3/c13-6-5-10(15)12(17)9-3-1-8(2-4-9)11(16)7-14/h1-4,10,12,15,17H,5-7,13-14H2 |
| InChIKey | GFTACNSUZDFKFC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |