C14H19NO4 — CID 171882116
methyl (E)-3-[4-(4-amino-1,2-dihydroxybutyl)phenyl]prop-2-enoate (PubChem CID 171882116) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (E)-3-[4-(4-amino-1,2-dihydroxybutyl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(4-amino-1,2-dihydroxybutyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 171882116 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl (E)-3-[4-(4-amino-1,2-dihydroxybutyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C(O)C(O)CCN)cc1 |
| InChI | InChI=1S/C14H19NO4/c1-19-13(17)7-4-10-2-5-11(6-3-10)14(18)12(16)8-9-15/h2-7,12,14,16,18H,8-9,15H2,1H3/b7-4+ |
| InChIKey | ZWKMEGLKAWWPOG-QPJJXVBHSA-N |
| XLogP | 0.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|