C14H16O5 — CID 132520989
methyl 2,3-dihydroxy-3-[4-[(E)-3-oxobut-1-enyl]phenyl]propanoate (PubChem CID 132520989) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-[4-[(E)-3-oxobut-1-enyl]phenyl]propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-[4-[(E)-3-oxobut-1-enyl]phenyl]propanoate |
|---|---|
| PubChem CID | 132520989 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | methyl 2,3-dihydroxy-3-[4-[(E)-3-oxobut-1-enyl]phenyl]propanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(/C=C/C(C)=O)cc1 |
| InChI | InChI=1S/C14H16O5/c1-9(15)3-4-10-5-7-11(8-6-10)12(16)13(17)14(18)19-2/h3-8,12-13,16-17H,1-2H3/b4-3+ |
| InChIKey | UAGOMQOIFYAMDC-ONEGZZNKSA-N |
| XLogP | 0.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|