C13H19NO5 — CID 171865295
methyl 2,3-dihydroxy-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]propanoate (PubChem CID 171865295) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 171865295 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 2,3-dihydroxy-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]propanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(N(C)CCO)cc1 |
| InChI | InChI=1S/C13H19NO5/c1-14(7-8-15)10-5-3-9(4-6-10)11(16)12(17)13(18)19-2/h3-6,11-12,15-17H,7-8H2,1-2H3 |
| InChIKey | TVLDFYJDVZSPPE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|