C12H16O6 — CID 171864351
methyl 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanoate (PubChem CID 171864351) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is methyl 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864351 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl 3-(3,5-dimethoxyphenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H16O6/c1-16-8-4-7(5-9(6-8)17-2)10(13)11(14)12(15)18-3/h4-6,10-11,13-14H,1-3H3 |
| InChIKey | VNHHHLPUMRZFHD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |