C9H9F2NO4 — CID 171865158
methyl 3-(2,6-difluoro-4-pyridinyl)-2,3-dihydroxypropanoate (PubChem CID 171865158) has the molecular formula C9H9F2NO4 and a molecular weight of 233.17 g/mol. Its IUPAC name is methyl 3-(2,6-difluoro-4-pyridinyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(2,6-difluoro-4-pyridinyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865158 |
| Molecular Formula | C9H9F2NO4 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 3-(2,6-difluoro-4-pyridinyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(F)nc(F)c1 |
| InChI | InChI=1S/C9H9F2NO4/c1-16-9(15)8(14)7(13)4-2-5(10)12-6(11)3-4/h2-3,7-8,13-14H,1H3 |
| InChIKey | PPTXWZATXJCJAL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|