About methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate
methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171863894) has the molecular formula C12H15ClO4
and a molecular weight of 258.70 g/mol. Its IUPAC name is methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate.
Analyze methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate?
The IUPAC name of methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate (CID 171863894) is methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate.
What is the SMILES notation for methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate?
The canonical SMILES for methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate is COC(=O)C(O)C(O)c1cc(C)c(Cl)c(C)c1.
What is the InChIKey of methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate?
The InChIKey is MOPKZBYTLOLZHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO4/c1-6-4-8(5-7(2)9(6)13)10(14)11(15)12(16)17-3/h4-5,10-11,14-15H,1-3H3.
What are the key properties of methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate?
methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate has a molecular weight of 258.70 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-chloro-3,5-dimethylphenyl)-2,3-dihydroxypropanoate is sourced from PubChem (CID 171863894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).