C10H9Cl2FO4 — CID 171863889
methyl 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 171863889) has the molecular formula C10H9Cl2FO4 and a molecular weight of 283.08 g/mol. Its IUPAC name is methyl 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171863889 |
| Molecular Formula | C10H9Cl2FO4 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | methyl 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(F)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2FO4/c1-17-10(16)9(15)8(14)4-2-5(11)7(12)6(13)3-4/h2-3,8-9,14-15H,1H3 |
| InChIKey | VCADKHNFSUOOOI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|