C9H7Cl2FO4 — CID 170823794
3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170823794) has the molecular formula C9H7Cl2FO4 and a molecular weight of 269.06 g/mol. Its IUPAC name is 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823794 |
| Molecular Formula | C9H7Cl2FO4 |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 3-(3,4-dichloro-5-fluorophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1cc(F)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2FO4/c10-4-1-3(2-5(12)6(4)11)7(13)8(14)9(15)16/h1-2,7-8,13-14H,(H,15,16) |
| InChIKey | YRCOQQJOQPCMLZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|