C9H9ClFNO3 — CID 81155550
2-amino-3-(3-chloro-4-fluorophenyl)-3-hydroxypropanoic acid (PubChem CID 81155550) has the molecular formula C9H9ClFNO3 and a molecular weight of 233.63 g/mol. Its IUPAC name is 2-amino-3-(3-chloro-4-fluorophenyl)-3-hydroxypropanoic acid.
| Compound Name | 2-amino-3-(3-chloro-4-fluorophenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 81155550 |
| Molecular Formula | C9H9ClFNO3 |
| Molecular Weight | 233.63 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-amino-3-(3-chloro-4-fluorophenyl)-3-hydroxypropanoic acid |
| SMILES | NC(C(=O)O)C(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClFNO3/c10-5-3-4(1-2-6(5)11)8(13)7(12)9(14)15/h1-3,7-8,13H,12H2,(H,14,15) |
| InChIKey | QBMOQMXPKQZDRJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.63 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |