C9H8F3NO3 — CID 66207167
2-amino-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 66207167) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-amino-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 2-amino-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 66207167 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-amino-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | NC(C(=O)O)C(O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H8F3NO3/c10-4-1-3(2-5(11)6(4)12)8(14)7(13)9(15)16/h1-2,7-8,14H,13H2,(H,15,16) |
| InChIKey | HQPYFBAGAAQCOL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|