C7H9N3O3 — CID 131186284
2-amino-3-hydroxy-3-pyrimidin-5-ylpropanoic acid (PubChem CID 131186284) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-amino-3-hydroxy-3-pyrimidin-5-ylpropanoic acid.
| Compound Name | 2-amino-3-hydroxy-3-pyrimidin-5-ylpropanoic acid |
|---|---|
| PubChem CID | 131186284 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-amino-3-hydroxy-3-pyrimidin-5-ylpropanoic acid |
| SMILES | NC(C(=O)O)C(O)c1cncnc1 |
| InChI | InChI=1S/C7H9N3O3/c8-5(7(12)13)6(11)4-1-9-3-10-2-4/h1-3,5-6,11H,8H2,(H,12,13) |
| InChIKey | BQOMYGOLLUNGQA-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |