C15H15NO3 — CID 66207160
2-amino-3-hydroxy-3-(4-phenylphenyl)propanoic acid (PubChem CID 66207160) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-amino-3-hydroxy-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 2-amino-3-hydroxy-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 66207160 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-amino-3-hydroxy-3-(4-phenylphenyl)propanoic acid |
| SMILES | NC(C(=O)O)C(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H15NO3/c16-13(15(18)19)14(17)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13-14,17H,16H2,(H,18,19) |
| InChIKey | BKVWPZXKWDNNNH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |