C16H16O6 — CID 70563433
1,1'-biphenyl;2,3-dihydroxybutanedioic acid (PubChem CID 70563433) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1,1'-biphenyl;2,3-dihydroxybutanedioic acid.
| Compound Name | 1,1'-biphenyl;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 70563433 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1,1'-biphenyl;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H6O6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;5-1(3(7)8)2(6)4(9)10/h1-10H;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | IPMHQPAZBMJZQH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |