C11H12O7 — CID 159567937
benzaldehyde;2,3-dihydroxybutanedioic acid (PubChem CID 159567937) has the molecular formula C11H12O7 and a molecular weight of 256.21 g/mol. Its IUPAC name is benzaldehyde;2,3-dihydroxybutanedioic acid.
| Compound Name | benzaldehyde;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 159567937 |
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | benzaldehyde;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C4H6O6/c8-6-7-4-2-1-3-5-7;5-1(3(7)8)2(6)4(9)10/h1-6H;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | MHLAWNDFYPKGKY-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|