C18H21NO6 — CID 175540511
N-benzyl-1-phenylmethanamine;2,3-dihydroxybutanedioic acid (PubChem CID 175540511) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;2,3-dihydroxybutanedioic acid.
| Compound Name | N-benzyl-1-phenylmethanamine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 175540511 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.C4H6O6/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;5-1(3(7)8)2(6)4(9)10/h1-10,15H,11-12H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ZVXSCDQFYGKQBM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |