C16H19NO4 — CID 172680795
(2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid;hydrate (PubChem CID 172680795) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid;hydrate.
| Compound Name | (2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid;hydrate |
|---|---|
| PubChem CID | 172680795 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid;hydrate |
| SMILES | O.O=C(O)[C@H](O)[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3.H2O/c18-15(16(19)20)14(13-9-5-2-6-10-13)17-11-12-7-3-1-4-8-12;/h1-10,14-15,17-18H,11H2,(H,19,20);1H2/t14-,15+;/m0./s1 |
| InChIKey | LDFWDCJIHJFSSC-LDXVYITESA-N |
| XLogP | 1.14 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |