C11H15NO7 — CID 162320499
N-benzylhydroxylamine;2,3-dihydroxybutanedioic acid (PubChem CID 162320499) has the molecular formula C11H15NO7 and a molecular weight of 273.24 g/mol. Its IUPAC name is N-benzylhydroxylamine;2,3-dihydroxybutanedioic acid.
| Compound Name | N-benzylhydroxylamine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 162320499 |
| Molecular Formula | C11H15NO7 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-benzylhydroxylamine;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.ONCc1ccccc1 |
| InChI | InChI=1S/C7H9NO.C4H6O6/c9-8-6-7-4-2-1-3-5-7;5-1(3(7)8)2(6)4(9)10/h1-5,8-9H,6H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ZTGOOWCZMDKYRW-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|