(2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid

C10H12O4 — CID 123932531

IUPAC(2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid
SMILESO=C(O)[C@@H](O)[C@H](O)Cc1ccccc1
InChIInChI=1S/C10H12O4/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7/h1-5,8-9,11-12H,6H2,(H,13,14)/t8-,9+/m1/s1
InChIKeyABBFZHZFAJYLDP-BDAKNGLRSA-N
MW196.20 g/mol
LogP0.04
Rot. Bonds4

About (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid

(2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid (PubChem CID 123932531) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid.

Molecular Properties

Compound Name(2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid
PubChem CID123932531
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name(2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid
SMILESO=C(O)[C@@H](O)[C@H](O)Cc1ccccc1
InChIInChI=1S/C10H12O4/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7/h1-5,8-9,11-12H,6H2,(H,13,14)/t8-,9+/m1/s1
InChIKeyABBFZHZFAJYLDP-BDAKNGLRSA-N
XLogP0.04
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 50.04
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid?
The IUPAC name of (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid (CID 123932531) is (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid.
What is the SMILES notation for (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid?
The canonical SMILES for (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid is O=C(O)[C@@H](O)[C@H](O)Cc1ccccc1.
What is the InChIKey of (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid?
The InChIKey is ABBFZHZFAJYLDP-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H12O4/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7/h1-5,8-9,11-12H,6H2,(H,13,14)/t8-,9+/m1/s1.
What are the key properties of (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid?
(2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid has a molecular weight of 196.20 g/mol, XLogP of 0.04, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2,3-dihydroxy-4-phenylbutanoic acid is sourced from PubChem (CID 123932531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).