C20H21ClO6 — CID 90985190
(3S,6R)-1-(4-chlorophenyl)-2,3,6,7-tetrahydroxy-8-phenyloctane-4,5-dione (PubChem CID 90985190) has the molecular formula C20H21ClO6 and a molecular weight of 392.84 g/mol. Its IUPAC name is (3S,6R)-1-(4-chlorophenyl)-2,3,6,7-tetrahydroxy-8-phenyloctane-4,5-dione.
| Compound Name | (3S,6R)-1-(4-chlorophenyl)-2,3,6,7-tetrahydroxy-8-phenyloctane-4,5-dione |
|---|---|
| PubChem CID | 90985190 |
| Molecular Formula | C20H21ClO6 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (3S,6R)-1-(4-chlorophenyl)-2,3,6,7-tetrahydroxy-8-phenyloctane-4,5-dione |
| SMILES | O=C(C(=O)[C@H](O)C(O)Cc1ccccc1)[C@@H](O)C(O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClO6/c21-14-8-6-13(7-9-14)11-16(23)18(25)20(27)19(26)17(24)15(22)10-12-4-2-1-3-5-12/h1-9,15-18,22-25H,10-11H2/t15?,16?,17-,18+/m1/s1 |
| InChIKey | XEFCTLGJAGJPJZ-HIEASXQVSA-N |
| XLogP | 0.71 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|