C26H34O6 — CID 54178101
(3R,6S)-2,3,6,7-tetrahydroxy-1,8-bis(4-propan-2-ylphenyl)octane-4,5-dione (PubChem CID 54178101) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (3R,6S)-2,3,6,7-tetrahydroxy-1,8-bis(4-propan-2-ylphenyl)octane-4,5-dione.
| Compound Name | (3R,6S)-2,3,6,7-tetrahydroxy-1,8-bis(4-propan-2-ylphenyl)octane-4,5-dione |
|---|---|
| PubChem CID | 54178101 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (3R,6S)-2,3,6,7-tetrahydroxy-1,8-bis(4-propan-2-ylphenyl)octane-4,5-dione |
| SMILES | CC(C)c1ccc(CC(O)[C@H](O)C(=O)C(=O)[C@H](O)C(O)Cc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H34O6/c1-15(2)19-9-5-17(6-10-19)13-21(27)23(29)25(31)26(32)24(30)22(28)14-18-7-11-20(12-8-18)16(3)4/h5-12,15-16,21-24,27-30H,13-14H2,1-4H3/t21?,22?,23-,24+ |
| InChIKey | OZWCKRIIDRDLGA-ULBZPVTCSA-N |
| XLogP | 2.30 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|