C13H19NO2 — CID 42329583
(2R)-2-(aminomethyl)-3-(4-propan-2-ylphenyl)propanoic acid (PubChem CID 42329583) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)-3-(4-propan-2-ylphenyl)propanoic acid.
| Compound Name | (2R)-2-(aminomethyl)-3-(4-propan-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 42329583 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2R)-2-(aminomethyl)-3-(4-propan-2-ylphenyl)propanoic acid |
| SMILES | CC(C)c1ccc(C[C@H](CN)C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-9(2)11-5-3-10(4-6-11)7-12(8-14)13(15)16/h3-6,9,12H,7-8,14H2,1-2H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | HNKBZBRLVYQWKW-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |