C15H25N — CID 81014991
2,3-dimethyl-4-(4-propan-2-ylphenyl)butan-1-amine (PubChem CID 81014991) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,3-dimethyl-4-(4-propan-2-ylphenyl)butan-1-amine.
| Compound Name | 2,3-dimethyl-4-(4-propan-2-ylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 81014991 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,3-dimethyl-4-(4-propan-2-ylphenyl)butan-1-amine |
| SMILES | CC(C)c1ccc(CC(C)C(C)CN)cc1 |
| InChI | InChI=1S/C15H25N/c1-11(2)15-7-5-14(6-8-15)9-12(3)13(4)10-16/h5-8,11-13H,9-10,16H2,1-4H3 |
| InChIKey | OWENRUXGTIKYCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |